
CAS 169530-97-6
:D-3-Nitrophe
Description:
D-3-Nitrophe, identified by its CAS number 169530-97-6, is a chemical compound that belongs to the class of nitrophenols. It typically exhibits characteristics common to nitrophenolic compounds, such as being a solid at room temperature and possessing a distinct yellow to brown coloration due to the presence of nitro groups. The nitro group (-NO2) is known to enhance the acidity of the phenolic hydroxyl group (-OH), which can influence the compound's reactivity and solubility in various solvents. D-3-Nitrophe may also demonstrate biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific structural configuration and substituents present. As with many nitro compounds, it is essential to handle D-3-Nitrophe with care due to potential toxicity and environmental impact. Always refer to safety data sheets and regulatory guidelines when working with such substances.
Formula:C9H10N2O4
InChI:InChI=1/C9H10N2O4/c10-8(9(12)13)5-6-2-1-3-7(4-6)11(14)15/h1-4,8H,5,10H2,(H,12,13)/t8-/m1/s1
SMILES:c1cc(cc(c1)N(=O)=O)C[C@H](C(=O)O)N
Synonyms:- D-3-Nitrophenylalanine
- (2R)-2-ammonio-3-(3-nitrophenyl)propanoate
- 3-Nitro-D-phenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Nitro-D-phenylalanine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H10N2O4Purity:95%Molecular weight:210.19


