CymitQuimica logo

CAS 16954-05-5

:

4,5-DIBROMO-1,2-DIMETHYL-1H-IMIDAZOLE

Description:
4,5-Dibromo-1,2-dimethyl-1H-imidazole is a heterocyclic organic compound characterized by its imidazole ring, which contains two nitrogen atoms in a five-membered ring structure. The presence of two bromine substituents at the 4 and 5 positions, along with two methyl groups at the 1 and 2 positions, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of nitrogen atoms, which can engage in hydrogen bonding. Its bromine substituents can enhance its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the imidazole ring is known for its biological significance, often found in various pharmaceuticals and agrochemicals. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4,5-dibromo-1,2-dimethyl-1H-imidazole is a compound of interest in both synthetic chemistry and medicinal applications.
Formula:C5H6Br2N2
InChI:InChI=1/C5H6Br2N2/c1-3-8-4(6)5(7)9(3)2/h1-2H3
InChI key:IRPMMLNFWNJAMH-UHFFFAOYSA-N
SMILES:Cc1nc(c(Br)n1C)Br
Synonyms:
  • 4,5-Dibromo-1,2-Dimethylimidazole
Found 5 products.