CAS 169544-41-6

ETHYL 4-(4-CHLOROPHENYL)-3-METHYL-2,4-DIOXO-BUTYRATE

Description:

Ethyl 4-(4-chlorophenyl)-3-methyl-2,4-dioxobutyrate, identified by CAS number 169544-41-6, is an organic compound characterized by its ester functional group and a complex molecular structure. It features a butyrate backbone with two carbonyl (keto) groups, contributing to its reactivity and potential applications in organic synthesis. The presence of a 4-chlorophenyl substituent enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The methyl group at the 3-position adds to the steric hindrance, which can affect the compound's interactions with other molecules. This compound is typically synthesized through multi-step organic reactions, and its properties may include moderate solubility in organic solvents and stability under standard laboratory conditions. Its potential applications could range from use in medicinal chemistry to serving as an intermediate in the synthesis of more complex organic molecules. As with many chemical substances, safety data should be consulted to understand its handling and toxicity profiles.

Formula: C₁₃H₁₃ClO₄

InChI: InChI=1/C13H13ClO4/c1-3-18-13(17)12(16)8(2)11(15)9-4-6-10(14)7-5-9/h4-8H,3H2,1-2H3

SMILES: CCOC(=O)C(=O)C(C)C(=O)c1ccc(cc1)Cl

Synonyms:

• 4-Chloro-Methyl-Dioxo Benzenebutanoic Acid Ethyl Ester
• 4-Chloro-Β-Methyl-Α,Γ-Dioxo-, Ethyl Ester
• Ethyl 4-(4-Chlorophenyl)-3-Methyl-2,4-Dioxobutanoate

Ethyl 4-(4-chlorophenyl)-3-methyl-2,4-dioxobutanoate

CAS: 169544-41-6

Ethyl 4-(4-chlorophenyl)-3-methyl-2,4-dioxobutanoate

Purity: ≥95%

Molecular weight: 268.69g/mol

Ref: 54-OR111464