CAS 169556-13-2

4-[methyl(phenyl)amino]butan-1-ol

Description:

4-[Methyl(phenyl)amino]butan-1-ol, identified by its CAS number 169556-13-2, is an organic compound characterized by the presence of a butanol backbone with a methyl(phenyl)amino group at the fourth carbon position. This compound features a hydroxyl (-OH) group, which contributes to its classification as an alcohol, and the presence of an amino group indicates potential basic properties. The phenyl group attached to the nitrogen atom enhances the compound's lipophilicity, potentially influencing its solubility and reactivity in organic solvents. The molecular structure suggests that it may exhibit both hydrophilic and hydrophobic characteristics, making it versatile in various chemical environments. Additionally, the compound may participate in hydrogen bonding due to the hydroxyl group, which can affect its boiling point and melting point. Its unique structure may also impart specific biological activities, making it of interest in pharmaceutical research. Overall, 4-[methyl(phenyl)amino]butan-1-ol is a compound with diverse potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₁H₁₇NO

InChI: InChI=1/C11H17NO/c1-12(9-5-6-10-13)11-7-3-2-4-8-11/h2-4,7-8,13H,5-6,9-10H2,1H3

SMILES: CN(CCCCO)c1ccccc1

4-[methyl(phenyl)amino]butan-1-ol

CAS: 169556-13-2

Formula: C₁₁H₁₇NO

Purity: 95.0%

Molecular weight: 179.263

Ref: 10-F310212