CAS 16956-91-5
:1,4-BIS(TRIMETHYLSILYL)TETRAFLUOROBENZENE
Description:
1,4-Bis(trimethylsilyl)tetrafluorobenzene, with the CAS number 16956-91-5, is an organosilicon compound characterized by the presence of two trimethylsilyl groups attached to a tetrafluorobenzene ring. This compound features a highly substituted aromatic system, which contributes to its unique chemical properties. The trimethylsilyl groups enhance the compound's hydrophobicity and thermal stability, making it useful in various applications, including as a precursor in organic synthesis and in materials science. The presence of fluorine atoms in the benzene ring imparts additional stability and alters the electronic properties of the molecule, potentially affecting its reactivity and interactions with other substances. 1,4-Bis(trimethylsilyl)tetrafluorobenzene is typically handled with care due to its chemical nature, and it may require specific storage conditions to maintain its integrity. Overall, this compound exemplifies the intersection of organosilicon chemistry and fluorinated compounds, showcasing the versatility and complexity of modern synthetic chemistry.
Formula:C12H18F4Si2
InChI:InChI=1/C12H18F4Si2/c1-17(2,3)11-7(13)9(15)12(18(4,5)6)10(16)8(11)14/h1-6H3
SMILES:C[Si](C)(C)c1c(c(c(c(c1F)F)[Si](C)(C)C)F)F
Synonyms:- (2,3,5,6-Tetrafluoro-1,4-phenylene)bis(trimethylsilane)
- Benzene, 1,2,4,5-tetrafluoro-3,6-bis(trimethylsilyl)-
- (2,3,5,6-Tetrafluorobenzene-1,4-Diyl)Bis(Trimethylsilane)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,4-Bis(trimethylsilyl)tetrafluorobenzene, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C12H18F4Si2Purity:98%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:294.44(Perfluoro-1,4-phenylene)bis(trimethylsilane)
CAS:Formula:C12H18F4Si2Color and Shape:SolidMolecular weight:294.43591,4-Bis(trimethylsilyl)tetrafluorobenzene
CAS:Formula:C12H18F4Si2Purity:98.0%Color and Shape:SolidMolecular weight:294.441,4-Bis(trimethylsilyl)-2,3,5,6-tetrafluorobenzene
CAS:<p>1,4-Bis(trimethylsilyl)-2,3,5,6-tetrafluorobenzene</p>Formula:C12H18F4Si2Purity:≥95%Color and Shape: solidMolecular weight:294.44g/mol1,4-Bis(Trimethylsilyl)tetrafluorobenzene
CAS:Controlled Product<p>Applications 1,4-Bis(Trimethylsilyl)Tetrafluorobenzene (cas# 16956-91-5) is a useful research chemical.<br></p>Formula:C12H18F4Si2Color and Shape:NeatMolecular weight:294.44




