CAS 169565-72-4
:cis-Zeatin-9-glucoside
Description:
Cis-Zeatin-9-glucoside is a naturally occurring cytokinin, a class of plant hormones that play a crucial role in regulating various aspects of plant growth and development. This compound is characterized by its structure, which includes a zeatin moiety linked to a glucose molecule, specifically at the 9-position. It is known for its ability to promote cell division, shoot initiation, and delay senescence in plants. The cis configuration indicates the spatial arrangement of the substituents around the double bond, which can influence its biological activity. As a glucoside, it is also involved in the storage and transport of zeatin within plant tissues. This compound is typically found in various plant species and can be extracted from plant tissues for research purposes. Its role in plant physiology makes it of interest in agricultural and horticultural applications, particularly in enhancing crop yield and quality. Additionally, its potential effects on human health and nutrition are being explored, given the increasing interest in plant-derived compounds.
Formula:C16H23N5O6
InChI:InChI=1S/C16H23N5O6/c1-8(4-22)2-3-17-14-10-15(19-6-18-14)21(7-20-10)16-13(26)12(25)11(24)9(5-23)27-16/h2,6-7,9,11-13,16,22-26H,3-5H2,1H3,(H,17,18,19)/b8-2-/t9-,11-,12+,13-,16-/m1/s1
InChI key:InChIKey=VYRAJOITMBSQSE-MTQUCLQASA-N
SMILES:O[C@H]1[C@H](N2C=3C(N=C2)=C(NC/C=C(\CO)/C)N=CN3)O[C@H](CO)[C@@H](O)[C@@H]1O
Synonyms:- (2Z)-4-[(9-β-D-Glucopyranosyl-9H-purin-6-yl)amino]-2-methyl-2-buten-1-ol
- 2-Buten-1-ol, 4-[(9-β-D-glucopyranosyl-9H-purin-6-yl)amino]-2-methyl-, (2Z)-
- cis-Zeatin-9-glucoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
cis-Zeatin-9-glucoside (cZ9G)
CAS:Controlled ProductFormula:C16H23N5O6Color and Shape:NeatMolecular weight:381.384cis-Zeatin-9-glucoside
CAS:<p>Cis-Zeatin-9-glucoside is a plant hormone known as a cytokinin, which is primarily synthesized in plants such as Zea mays (corn) and other monocots. Cytokinins play a critical role in regulating plant growth and development by promoting cell division, influencing nutrient allocation, and delaying leaf senescence. The mode of action of cis-Zeatin-9-glucoside involves its role as a signaling molecule that interacts with specific receptors in plant cells, thereby triggering a cascade of gene expression changes that modulate physiological processes.</p>Formula:C16H23N5O6Purity:Min. 95%Color and Shape:PowderMolecular weight:381.38 g/mol

