CAS 16966-09-9
:O-(1,1-Dimethylethyl)-N-[(phenylmethoxy)carbonyl]-L-threonine
Description:
O-(1,1-Dimethylethyl)-N-[(phenylmethoxy)carbonyl]-L-threonine, with CAS number 16966-09-9, is a synthetic amino acid derivative that features a threonine backbone modified with specific protective groups. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) at the oxygen position, which enhances its stability and solubility. The phenylmethoxycarbonyl group attached to the nitrogen atom serves as a protective moiety, making it useful in peptide synthesis and other organic reactions. The structure of this compound allows for selective reactions, facilitating the introduction of further functional groups or the formation of peptide bonds. Its chirality, stemming from the L-threonine configuration, contributes to its biological relevance, particularly in pharmaceutical applications. Overall, this compound is significant in the field of medicinal chemistry and peptide synthesis due to its unique structural features and functional versatility.
Formula:C16H23NO5
InChI:InChI=1S/C16H23NO5/c1-11(22-16(2,3)4)13(14(18)19)17-15(20)21-10-12-8-6-5-7-9-12/h5-9,11,13H,10H2,1-4H3,(H,17,20)(H,18,19)/t11-,13+/m1/s1
InChI key:InChIKey=QJYMOTAFFJDTAG-YPMHNXCESA-N
SMILES:[C@H](NC(OCC1=CC=CC=C1)=O)([C@H](OC(C)(C)C)C)C(O)=O
Synonyms:- <span class="text-smallcaps">L</span>-Threonine, O-(1,1-dimethylethyl)-N-[(phenylmethoxy)carbonyl]-
- Butyric acid, 3-tert-butoxy-2-(carboxyamino)-, N-benzyl ester
- N-(Benzyloxycarbonyl)-O-tert-butyl-<span class="text-smallcaps">L</span>-threonine
- N-[(Benzyloxy)carbonyl]-O-tert-butyl-L-threonine
- O-(1,1-Dimethylethyl)-N-[(phenylmethoxy)carbonyl]-<span class="text-smallcaps">L</span>-threonine
- L-Threonine, O-(1,1-dimethylethyl)-N-[(phenylmethoxy)carbonyl]-
- O-(1,1-Dimethylethyl)-N-[(phenylmethoxy)carbonyl]-L-threonine
- N-(Benzyloxycarbonyl)-O-tert-butyl-L-threonine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
L-Threonine, O-(1,1-dimethylethyl)-N-[(phenylmethoxy)carbonyl]-
CAS:Formula:C16H23NO5Purity:98%Color and Shape:SolidMolecular weight:309.3575N-((Benzyloxy)Carbonyl)-O-(Tert-Butyl)-L-Threonine
CAS:N-((Benzyloxy)Carbonyl)-O-(Tert-Butyl)-L-ThreoninePurity:98%Molecular weight:309.36g/mol(2S,3R)-2-(((Benzyloxy)carbonyl)amino)-3-(tert-butoxy)butanoic acid
CAS:Formula:C16H23NO5Purity:98%Color and Shape:SolidMolecular weight:309.362(2S,3R)-2-(((Benzyloxy)carbonyl)amino)-3-(tert-butoxy)butanoic acid
CAS:(2S,3R)-2-(((Benzyloxy)carbonyl)amino)-3-(tert-butoxy)butanoic acid, also known as (2S,3R)-2-(((benzyloxy)carbonyl)amino)-3-(tert-butoxy)butanoic acid or 2S,3R-Dibenzylglycine tert-Butyl Ester is an amino acid that is used in the synthesis of peptides. It is a biochemical that can be synthesized from l-threonine and chloroformate. This compound can be derived from plant sources such as saponified castor oil. The synthesis of this compound involves the dehydration of isobutene to form tetrahydrofuran and then reacting it with thionyl chloride to produce chloride ions. The l-threonine methyl ester reacts with the chloride ion to form an activated esterFormula:C16H23NO5Purity:Min. 95%Molecular weight:309.36 g/mol



