CAS 169674-08-2

4-Chloro-5-fluoro-1H-indole-2-carboxylic acid

Description:

4-Chloro-5-fluoro-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of chlorine and fluorine substituents at the 4 and 5 positions, respectively, enhances its reactivity and may influence its biological activity. Typically, compounds like this are of interest in medicinal chemistry due to their potential pharmacological properties. The molecular structure allows for various interactions, making it a candidate for studies in drug development. Additionally, the compound's solubility and stability can be affected by the substituents, which may also play a role in its application in synthetic organic chemistry. Overall, 4-Chloro-5-fluoro-1H-indole-2-carboxylic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₉H₅ClFNO₂

InChI: InChI=1S/C9H5ClFNO2/c10-8-4-3-7(9(13)14)12-6(4)2-1-5(8)11/h1-3,12H,(H,13,14)

InChI key: InChIKey=VPXADRLFOWLPHM-UHFFFAOYSA-N

SMILES: ClC1=C2C(NC(C(O)=O)=C2)=CC=C1F

Synonyms:

• 4-Chloro-5-fluoro-1H-indole-2-carboxylic acid
• 1H-Indole-2-carboxylic acid, 4-chloro-5-fluoro-

4-Chloro-5-fluoro-1H-indole-2-carboxylic acid

CAS: 169674-08-2

Versatile small molecule scaffold

Formula: C₉H₅ClFNO₂

Purity: Min. 95%

Molecular weight: 213.59 g/mol

Ref: 3D-UGA67408