CAS 169674-57-1
:5-Chloro-6-fluoroindole
Description:
5-Chloro-6-fluoroindole is a heterocyclic organic compound that belongs to the indole family, characterized by a bicyclic structure containing a fused benzene and pyrrole ring. This compound features a chlorine atom at the 5-position and a fluorine atom at the 6-position of the indole ring, which contributes to its unique chemical properties and reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of halogen substituents can influence its electronic properties, making it a potential candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, 5-chloro-6-fluoroindole may participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, due to the reactivity of the indole nitrogen and the halogen substituents. Its specific applications and behavior in chemical reactions can vary based on the surrounding conditions and the presence of other functional groups.
Formula:C7H5F3OS
InChI:InChI=1/C7H5F3OS/c8-7(9,10)11-5-1-3-6(12)4-2-5/h1-4,12H
SMILES:c1cc(ccc1OC(F)(F)F)S
Synonyms:- 5-chloro-6-fluoro-1H-indole
- 4-(Trifluoromethoxy)Benzenethiol
- 1H-indole, 5-chloro-6-fluoro-
- 5-Chlor-6-fluor-1H-indol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Chloro-6-fluoro-1H-indole
CAS:Formula:C8H5ClFNPurity:98%Color and Shape:SolidMolecular weight:169.58345-Chloro-6-fluoro-1H-indole
CAS:<p>5-Chloro-6-fluoro-1H-indole</p>Purity:97%Color and Shape:White To Beige SolidMolecular weight:169.58g/mol5-Chloro-6-fluoroindole
CAS:<p>Please enquire for more information about 5-Chloro-6-fluoroindole including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C8H5ClFNPurity:Min. 95%Molecular weight:169.58 g/mol5-Chloro-6-fluoroindole
CAS:<p>5-Chloro-6-fluoroindole is a fine chemical that can be used as a versatile building block in the synthesis of complex compounds. It is also a useful intermediate in organic reactions. This chemical has been used in the synthesis of high quality reagents, and as an important reaction component in research chemicals. CAS No. 169674-57-1</p>Formula:C8H5ClFNMolecular weight:169.59 g/mol



