CymitQuimica logo

CAS 169750-97-4

:

3-(1H-Pyrrol-1-yl)piperidine

Description:
3-(1H-Pyrrol-1-yl)piperidine, identified by its CAS number 169750-97-4, is a chemical compound characterized by its unique structure, which features a piperidine ring substituted with a pyrrole group. This compound typically exhibits properties associated with both heterocyclic amines, contributing to its potential biological activity. It is a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of nitrogen atoms in both the piperidine and pyrrole rings can influence its reactivity and solubility in various solvents, often making it soluble in polar organic solvents. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its structural features suggest potential interactions with biological targets, which could lead to applications in therapeutic contexts. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C9H14N2
InChI:InChI=1S/C9H14N2/c1-2-7-11(6-1)9-4-3-5-10-8-9/h1-2,6-7,9-10H,3-5,8H2
InChI key:InChIKey=MSVVJUQLGSKKPB-UHFFFAOYSA-N
SMILES:N1(C=CC=C1)C2CCCNC2
Synonyms:
  • Piperidine, 3-(1H-pyrrol-1-yl)-
  • 3-(1H-Pyrrol-1-yl)piperidine
  • 3-Pyrrol-1-ylpiperidine
Found 1 products.