CAS 1698-31-3: 4-BENZHYDRYL-PIPERAZIN-1-YLAMINE
Description:4-Benzhydryl-piperazin-1-ylamine, with the CAS number 1698-31-3, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a benzhydryl group, which is a phenyl group attached to a phenylmethane moiety, contributing to its lipophilicity and potential biological activity. It is typically a white to off-white solid at room temperature and is soluble in organic solvents. The presence of the piperazine moiety suggests potential applications in medicinal chemistry, particularly in the development of psychoactive drugs or as a scaffold for various pharmacological agents. Its structure allows for interactions with various biological targets, making it of interest in research related to neuropharmacology and other therapeutic areas. As with many amines, it may exhibit basic properties and can participate in hydrogen bonding, influencing its reactivity and interactions in biological systems. Safety and handling precautions should be observed due to its potential biological activity.
Formula:C17H21N3
InChI:InChI=1/C17H21N3/c18-20-13-11-19(12-14-20)17(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17H,11-14,18H2
- Synonyms:
- 1-Ammonio-4-(Diphenylmethyl)Piperazinediium
- 4-(Diphenylmethyl)Piperazin-1-Amine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-(Diphenylmethyl)piperazin-1-amine REF: 3D-BAA69831CAS: 1698-31-3 | Min. 95% | To inquire | Wed 07 May 25 |
![]() | 4-(Diphenylmethyl)piperazin-1-amine REF: 10-F643172CAS: 1698-31-3 | 98% | - - - | Discontinued product |

4-(Diphenylmethyl)piperazin-1-amine
Ref: 3D-BAA69831
1g | 1,014.00 € | ||
100mg | 403.00 € |

Ref: 10-F643172
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |