CAS 16980-82-8
:Cinnamic acid, 3-hydroxy-4-methoxy-, methyl ester
Description:
Cinnamic acid, 3-hydroxy-4-methoxy-, methyl ester, also known by its CAS number 16980-82-8, is an organic compound that belongs to the class of cinnamic acid derivatives. It features a methoxy group and a hydroxyl group on the aromatic ring, contributing to its unique chemical properties. This compound typically appears as a white to pale yellow crystalline solid and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water. It exhibits characteristic aromatic properties due to the presence of the phenyl group, and its structure allows for potential applications in the fields of pharmaceuticals, cosmetics, and food additives. The compound may also possess antioxidant and antimicrobial activities, making it of interest in various research areas. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, this compound is notable for its functional groups that enhance its versatility in chemical reactions and applications.
Formula:C11H12O4
InChI:InChI=1/C11H12O4/c1-14-10-5-3-8(7-9(10)12)4-6-11(13)15-2/h3-7,12H,1-2H3/b6-4+
Synonyms:- Methyl isoferulate
- methyl (2E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl Isoferulate
CAS:This product is isolated and purified from the leaves of Phyllostachys heterocyclaFormula:C11H12O4Purity:99.71%Color and Shape:SolidMolecular weight:208.21Ref: TM-T4394
1mg79.00€5mg219.00€10mg314.00€25mg477.00€50mg637.00€100mg857.00€200mg1,153.00€1mL*10mM (DMSO)212.00€Methyl 3-(3-hydroxy-4-methoxyphenyl)acrylate
CAS:Methyl 3-(3-hydroxy-4-methoxyphenyl)acrylate is a compound that has been shown to be active against viruses. It is a derivative of salvianolic acid, which has been found to have anti-inflammatory and antiviral properties. Salvianolic acid and its derivatives are produced by the plant Salvia miltiorrhiza Bunge, and are known for their use in traditional Chinese medicine. The mechanism of action of methyl 3-(3-hydroxy-4-methoxyphenyl)acrylate is not yet fully understood, but it may inhibit the replication of influenza virus by binding to the RNA polymerase in the virus. This drug also has a hydrogen bond with cinnamic acid derivatives, which can inhibit HIV replication.Formula:C11H12O4Purity:Min. 95%Molecular weight:208.21 g/mol


