CAS 169808-00-8

4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzonitrile

Description:

4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzonitrile, with the CAS number 169808-00-8, is a chemical compound characterized by its unique structural features, which include a benzonitrile moiety and an imidazolidinone ring. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its polar functional groups. The presence of the dioxoimidazolidin ring suggests potential reactivity, particularly in nucleophilic addition reactions, while the benzonitrile group may impart aromatic stability and influence its electronic properties. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its physical properties and reactivity. Overall, this compound's characteristics make it a subject of interest in both synthetic chemistry and potential applications in drug development.

Formula: C₁₁H₉N₃O₂

InChI: InChI=1/C11H9N3O2/c1-11(9(15)13-10(16)14-11)8-4-2-7(6-12)3-5-8/h2-5H,1H3,(H2,13,14,15,16)

SMILES: CC1(c2ccc(cc2)C#N)C(=NC(=N1)O)O

4-(4-Methyl-2,5-dioxoimidazolidin-4-yl)benzonitrile

CAS: 169808-00-8

Versatile small molecule scaffold

Formula: C₁₁H₉N₃O₂

Purity: Min. 95%

Molecular weight: 215.21 g/mol

Ref: 3D-UGA80800