CAS 169814-48-6

1-[3-(4-chlorophenyl)-5-methylisoxazol-4-yl]ethan-1-one

Description:

1-[3-(4-chlorophenyl)-5-methylisoxazol-4-yl]ethan-1-one, with the CAS number 169814-48-6, is a chemical compound characterized by its isoxazole ring structure, which contributes to its potential biological activity. The presence of a 4-chlorophenyl group enhances its lipophilicity, potentially influencing its interaction with biological targets. This compound features a ketone functional group, which may play a role in its reactivity and stability. The methyl group on the isoxazole ring can affect the compound's steric properties and electronic distribution. Typically, compounds of this nature are investigated for their pharmacological properties, including anti-inflammatory or analgesic effects, due to the structural motifs that often correlate with biological activity. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Safety and handling precautions are essential, as with many organic compounds, to mitigate any potential hazards associated with exposure.

Formula: C₁₂H₁₀ClNO₂

InChI: InChI=1/C12H10ClNO2/c1-7(15)11-8(2)16-14-12(11)9-3-5-10(13)6-4-9/h3-6H,1-2H3

SMILES: CC(=O)c1c(C)onc1c1ccc(cc1)Cl

Synonyms:

• 1-[3-(4-Chlorophenyl)-5-Methylisoxazol-4-Yl]Ethanone

4-Acetyl-3-(4-chlorophenyl)-5-methylisoxazole

CAS: 169814-48-6

4-Acetyl-3-(4-chlorophenyl)-5-methylisoxazole

Purity: 95%

Molecular weight: 235.67g/mol

Ref: 54-OR01994

1-[3-(4-Chloro-phenyl)-5-methyl-isoxazol-4-yl]-ethanone

CAS: 169814-48-6

Formula: C₁₂H₁₀ClNO₂

Purity: 95.0%

Molecular weight: 235.67

Ref: 10-F317456