
CAS 169815-81-0
:Furo[2,3-b]pyridine-5-methanol
Description:
Furo[2,3-b]pyridine-5-methanol is a heterocyclic organic compound characterized by its fused furan and pyridine rings, which contribute to its unique chemical properties. This compound features a hydroxymethyl group (-CH2OH) at the 5-position of the pyridine ring, enhancing its reactivity and potential for further chemical modifications. The presence of both nitrogen and oxygen in its structure allows for diverse interactions, making it of interest in medicinal chemistry and material science. Furo[2,3-b]pyridine derivatives are often studied for their biological activities, including antimicrobial and anti-inflammatory properties. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in various chemical reactions and formulations. Additionally, its molecular structure may influence its ability to participate in hydrogen bonding and other intermolecular interactions, further affecting its behavior in biological systems and synthetic processes. Overall, Furo[2,3-b]pyridine-5-methanol represents a valuable scaffold for the development of novel therapeutic agents and functional materials.
Formula:C8H7NO2
InChI:InChI=1S/C8H7NO2/c10-5-6-3-7-1-2-11-8(7)9-4-6/h1-4,10H,5H2
InChI key:InChIKey=WHLVYONEGXBNHS-UHFFFAOYSA-N
SMILES:C(O)C=1C=C2C(=NC1)OC=C2
Synonyms:- Furo[2,3-b]pyridine-5-methanol
- Furo[2,3-b]pyridin-5-ylmethanol
- 5-(Hydroxymethyl)furo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.