CymitQuimica logo

CAS 169899-49-4

:

Cyclobutanecarboxylic acid, 3-hydroxy-1-methyl-, methyl ester (9CI)

Description:
Cyclobutanecarboxylic acid, 3-hydroxy-1-methyl-, methyl ester, also known by its CAS number 169899-49-4, is an organic compound characterized by its cyclobutane ring structure, which is a four-membered carbon ring. This compound features a carboxylic acid functional group and a methyl ester, indicating that it has both acidic and ester functionalities. The presence of a hydroxyl group at the 3-position contributes to its reactivity and potential for hydrogen bonding, which can influence its solubility and boiling point. Typically, compounds of this nature may exhibit moderate polarity due to the combination of functional groups, making them soluble in polar solvents. Cyclobutanecarboxylic acid derivatives are of interest in various fields, including medicinal chemistry and materials science, due to their unique structural properties and potential biological activities. As with many organic compounds, safety data should be consulted for handling and usage, as they may pose health risks or environmental hazards.
Formula:C7H12O3
InChI:InChI=1S/C7H12O3/c1-7(6(9)10-2)3-5(8)4-7/h5,8H,3-4H2,1-2H3
InChI key:KFLCCZPFOPDGLN-UHFFFAOYSA-N
SMILES:CC1(CC(C1)O)C(=O)OC
Found 3 products.