CAS 16994-01-7

2-Azabicyclo[3.2.1]octane, hydrochloride (1:1)

Description:

2-Azabicyclo[3.2.1]octane, hydrochloride (1:1), with the CAS number 16994-01-7, is a bicyclic organic compound characterized by its unique bicyclic structure that includes a nitrogen atom within the ring system. This compound is a derivative of bicyclic amines and is often utilized in medicinal chemistry due to its potential pharmacological properties. The hydrochloride form indicates that the compound is in a salt form, which enhances its solubility in water and stability, making it suitable for various applications, including drug formulation. The presence of the nitrogen atom contributes to its basicity and reactivity, allowing it to participate in various chemical reactions. Additionally, this compound may exhibit biological activity, making it of interest in the development of therapeutic agents. Its structural features, including the arrangement of carbon and nitrogen atoms, play a crucial role in determining its chemical behavior and interactions with biological systems. Overall, 2-Azabicyclo[3.2.1]octane hydrochloride is significant in both synthetic and medicinal chemistry contexts.

Formula: C₇H₁₃N·ClH

InChI: InChI=1S/C7H13N.ClH/c1-2-7-5-6(1)3-4-8-7;/h6-8H,1-5H2;1H

InChI key: InChIKey=RWEWCCOKDMZBBE-UHFFFAOYSA-N

SMILES: C12CC(CC1)NCC2.Cl

Synonyms:

• 2-Azabicyclo[3.2.1]octane, hydrochloride
• 2-Azabicyclo[3.2.1]octane, hydrochloride (1:1)

2-Azabicyclo[3.2.1]octane hydrochloride

CAS: 16994-01-7

Versatile small molecule scaffold

Formula: C₇H₁₄ClN

Purity: Min. 95%

Molecular weight: 147.6 g/mol

Ref: 3D-RAA99401