CAS 1700-12-5: 1,6-Bis(2-hydroxyethyl) hexanedioate

Description:1,6-Bis(2-hydroxyethyl) hexanedioate, also known by its CAS number 1700-12-5, is an organic compound characterized by its structure, which features a hexanedioate backbone with two hydroxyethyl groups attached at the 1 and 6 positions. This compound is a diester, which means it contains two ester functional groups, contributing to its reactivity and solubility properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of hydroxyl groups enhances its hydrophilicity, making it soluble in water and various organic solvents. This compound is often utilized in the synthesis of polyesters and as a plasticizer in polymer formulations, owing to its ability to improve flexibility and processability. Additionally, it may exhibit low toxicity, making it suitable for applications in food packaging and other consumer products. Its chemical stability and functional versatility make it a valuable intermediate in organic synthesis and materials science.

Formula:C₁₀H₁₈O₆

InChI:InChI=1S/C10H18O6/c11-5-7-15-9(13)3-1-2-4-10(14)16-8-6-12/h11-12H,1-8H2

InChI key:InChIKey=RCZKTFHQZNLYAR-UHFFFAOYSA-N

SMILES:O=C(OCCO)CCCCC(=O)OCCO