CAS 170017-73-9

1-TERT-BUTOXYCARBONYL-4-(2-NITROPHENYL)PIPERAZINE

Description:

1-Tert-Butoxycarbonyl-4-(2-nitrophenyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The tert-butoxycarbonyl (Boc) group serves as a protective group for amines, enhancing the compound's stability and solubility in organic solvents. The presence of the 2-nitrophenyl substituent introduces electron-withdrawing characteristics, which can influence the compound's reactivity and interaction with biological targets. This compound is often utilized in medicinal chemistry and drug development due to its potential pharmacological properties. Its structure allows for various modifications, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, the compound's properties, such as melting point, solubility, and reactivity, can be influenced by the specific functional groups attached to the piperazine ring. Overall, 1-tert-butoxycarbonyl-4-(2-nitrophenyl)piperazine is an important compound in the field of organic synthesis and pharmaceutical research.

Formula: C₁₅H₂₁N₃O₄

InChI: InChI=1/C15H21N3O4/c1-15(2,3)22-14(19)17-10-8-16(9-11-17)12-6-4-5-7-13(12)18(20)21/h4-7H,8-11H2,1-3H3

SMILES: CC(C)(C)OC(=O)N1CCN(CC1)c1ccccc1N(=O)=O

Synonyms:

• Tert-Butyl 4-(2-Nitrophenyl)Piperazine-1-Carboxylate

1-Boc-4-(2-nitrophenyl)piperazine

CAS: 170017-73-9

Formula: C₁₅H₂₁N₃O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 307.3449

Ref: IN-DA003E1H

1-Boc-4-(2-nitrophenyl)piperazine

CAS: 170017-73-9

1-Boc-4-(2-nitrophenyl)piperazine

Purity: 98%

Molecular weight: 307.34g/mol

Ref: 54-OR95323

tert-Butyl 4-(2-nitrophenyl)piperazine-1-carboxylate

CAS: 170017-73-9

Formula: C₁₅H₂₁N₃O₄

Purity: 96%

Molecular weight: 307.35

Ref: 10-F436760