CAS 17003-75-7
:2-fluoro-2,2-dinitroethanol
Description:
2-Fluoro-2,2-dinitroethanol is an organic compound characterized by the presence of a fluorine atom and two nitro groups attached to a central ethanol structure. Its molecular formula typically includes carbon, hydrogen, nitrogen, and oxygen, reflecting its functional groups. The presence of the dinitro groups contributes to its potential as a high-energy material, making it of interest in the field of explosives and propellants. The fluorine atom can influence the compound's reactivity and stability, often enhancing its performance in various chemical reactions. In terms of physical properties, 2-fluoro-2,2-dinitroethanol may exhibit a relatively low solubility in water, while being more soluble in organic solvents. Safety considerations are paramount, as compounds with nitro groups can be sensitive to heat and shock, necessitating careful handling and storage. Overall, this compound's unique structure and properties make it a subject of study in both synthetic chemistry and materials science.
Formula:C2H3FN2O5
InChI:InChI=1/C2H3FN2O5/c3-2(1-6,4(7)8)5(9)10/h6H,1H2
InChI key:InChIKey=DKSPPEUUPARRFY-UHFFFAOYSA-N
SMILES:C(N(=O)=O)(N(=O)=O)(CO)F
Synonyms:- 2,2-Dinitro-2-fluoroethanol
- 2-Fluoro-2,2-dinitroethan-1-ol
- Brn 1841612
- Ethanol, 2,2-dinitro-2-fluoro-
- Ethanol, 2-fluoro-2,2-dinitro-
- 2-Fluoro-2,2-dinitroethanol
- 2-Fluoro-2,2-dinitroethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.