CAS 17008-69-4

(3beta,5beta,12alpha)-3,12,14-trihydroxy-11-oxobufa-20,22-dienolide

Description:

The chemical substance known as (3beta,5beta,12alpha)-3,12,14-trihydroxy-11-oxobufa-20,22-dienolide, with the CAS number 17008-69-4, is a naturally occurring compound classified as a steroid. It features multiple hydroxyl groups, which contribute to its solubility and reactivity, and an oxo group that indicates the presence of a carbonyl functional group. This compound is characterized by its unique steroidal structure, which includes a specific arrangement of double bonds and hydroxyl groups that can influence its biological activity. Such compounds often exhibit various pharmacological properties, including potential anti-inflammatory and immunomodulatory effects. The presence of multiple functional groups allows for interactions with biological receptors, making it of interest in medicinal chemistry and pharmacology. Its structural complexity and stereochemistry are critical for its biological function and efficacy. As with many steroid derivatives, it may also play a role in various biochemical pathways, contributing to its significance in research and potential therapeutic applications.

Formula: C₂₄H₃₂O₆

InChI: InChI=1S/C24H32O6/c1-22-9-7-15(25)11-14(22)4-5-17-19(22)20(27)21(28)23(2)16(8-10-24(17,23)29)13-3-6-18(26)30-12-13/h3,6,12,14-17,19,21,25,28-29H,4-5,7-11H2,1-2H3/t14-,15+,16-,17-,19-,21+,22+,23+,24+/m1/s1

InChI key: InChIKey=SOGONHOGEFLVPE-BHZHDSHXSA-N

SMILES: C[C@@]12[C@@](O)([C@]3([C@](C(=O)[C@@H]1O)([C@]4(C)[C@](CC3)(C[C@@H](O)CC4)[H])[H])[H])CC[C@@]2(C=5C=CC(=O)OC5)[H]

Pseudobufarenogin

CAS: 17008-69-4

Formula: C₂₄H₃₂O₆

Molecular weight: 416.51

Ref: 7W-GY9166

Pseudobufarenogin

CAS: 17008-69-4

Pseudobufarenogin

Purity: ≥98%

Molecular weight: 416.51g/mol

Ref: 54-BUP00411

Pseudobufarenogin

CAS: 17008-69-4

Pseudobufarenogin(ψ-bufarenogin), a novel anti-tumor compound, suppresses liver cancer growth by inhibiting receptor tyrosine kinase-mediated signaling. ψ-Bufarenogin shows inhibition of human kidney Na(+)/K(+)-ATPase activity.

Formula: C₂₄H₃₂O₆

Purity: 95%~99%

Molecular weight: 416.514

Ref: BP-BP3331

Pseudobufarenogin

CAS: 17008-69-4

Pseudobufarenogin (ψ-Bufarenogin), a novel anti-tumor compound, suppresses liver cancer growth by inhibiting receptor tyrosine kinase-mediated signaling.

Formula: C₂₄H₃₂O₆

Purity: 99.34%

Color and Shape: Solid

Molecular weight: 416.51

Ref: TM-TQ0065