CAS 1701-57-1
:2,3,4,5-Tetrahydro-1H-benzo[b]azepine
Description:
2,3,4,5-Tetrahydro-1H-benzo[b]azepine is a bicyclic organic compound characterized by its fused benzene and azepine rings. It features a seven-membered nitrogen-containing heterocycle, which contributes to its unique chemical properties. The compound is typically colorless to pale yellow and may exhibit a distinct odor. It is soluble in organic solvents, such as ethanol and dichloromethane, but has limited solubility in water due to its hydrophobic nature. The presence of the nitrogen atom in the azepine ring can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cyclizations. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological activities, as derivatives of azepines have been explored for their effects on the central nervous system. Safety data indicates that it should be handled with care, as with many organic compounds, due to potential toxicity and reactivity. Overall, 2,3,4,5-Tetrahydro-1H-benzo[b]azepine serves as a valuable structure in both synthetic and medicinal chemistry.
Formula:C10H13N
InChI:InChI=1/C10H13N/c1-2-7-10-9(5-1)6-3-4-8-11-10/h1-2,5,7,11H,3-4,6,8H2
SMILES:c1ccc2c(c1)CCCCN2
Synonyms:- 1H-1-Benzazepine, 2,3,4,5-tetrahydro-
- 2,3,4,5-Tetrahydro-1H-1-benzazepine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-1-Benzazepine, 2,3,4,5-tetrahydro-
CAS:Formula:C10H13NPurity:96%Color and Shape:LiquidMolecular weight:147.21692,3,4,5-Tetrahydro-1H-benzo[b]azepine
CAS:2,3,4,5-Tetrahydro-1H-benzo[b]azepinePurity:98%Molecular weight:147.22g/mol2,3,4,5-Tetrahydro-1H-benzo[b]azepine
CAS:Formula:C10H13NPurity:97%Color and Shape:LiquidMolecular weight:147.2212,3,4,5-Tetrahydro-1H-benzo[b]azepine
CAS:2,3,4,5-Tetrahydro-1H-benzo[b]azepine is a quinoline derivative that has been shown to be an agonist of the 5HT2C receptor. It has been shown to have minimal activity in vivo. This compound has also been shown to inhibit histone H3 phosphorylation and anticholinesterase activity in vitro. The molecular modeling studies suggest that this molecule binds to brain cells by interacting with the hydroxyl group on the cyclohexane ring and amino acids such as dopamine and histone h3. 2,3,4,5-Tetrahydro-1H-benzo[b]azepine has a high affinity for the 5HT2C receptor and produces similar effects as other related compounds.Formula:C10H13NPurity:Min. 95%Color and Shape:White PowderMolecular weight:147.22 g/mol



