CymitQuimica logo

CAS 1701-72-0

:

1-(pyridin-3-yl)pentan-1-one

Description:
1-(Pyridin-3-yl)pentan-1-one, also known by its CAS number 1701-72-0, is an organic compound characterized by its structure, which features a pentanone backbone with a pyridine ring substituted at the third position. This compound typically exhibits a polar nature due to the presence of the carbonyl group (ketone) and the nitrogen atom in the pyridine ring, which can influence its solubility in various solvents. It is likely to be a liquid at room temperature, with a distinct odor, and may have applications in organic synthesis and medicinal chemistry due to its structural properties. The presence of the pyridine moiety suggests potential biological activity, as many pyridine derivatives are known for their pharmacological effects. Additionally, the compound's reactivity can be attributed to the carbonyl group, making it a candidate for various chemical reactions, including nucleophilic additions and condensation reactions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H13NO
InChI:InChI=1/C10H13NO/c1-2-3-6-10(12)9-5-4-7-11-8-9/h4-5,7-8H,2-3,6H2,1H3
SMILES:CCCCC(=O)c1cccnc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.