CAS 170105-17-6
:2-Ethyl-α,α-diphenyl-1H-imidazole-1-butanenitrile
Description:
2-Ethyl-α,α-diphenyl-1H-imidazole-1-butanenitrile, with the CAS number 170105-17-6, is a chemical compound that belongs to the class of imidazole derivatives. This substance typically exhibits a complex structure characterized by the presence of an imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The compound features a butanenitrile group, indicating the presence of a cyano functional group (-C≡N) attached to a butane chain, which contributes to its reactivity and potential applications in various chemical processes. The ethyl and diphenyl substituents enhance its lipophilicity and may influence its biological activity. Generally, compounds of this nature are studied for their potential roles in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific physical and chemical properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which the compound is used.
Formula:C21H21N3
InChI:InChI=1S/C21H21N3/c1-2-20-23-14-16-24(20)15-13-21(17-22,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,14,16H,2,13,15H2,1H3
InChI key:InChIKey=BYRMTPIQFVOLFK-UHFFFAOYSA-N
SMILES:C(CCN1C(CC)=NC=C1)(C#N)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 2-Ethyl-α,α-diphenyl-1H-imidazole-1-butanenitrile
- 1H-Imidazole-1-butanenitrile, 2-ethyl-α,α-diphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
