CAS 170108-05-1

2-bromo-3,4-difluorobenzoic acid

Description:

2-Bromo-3,4-difluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and two fluorine atoms on the benzene ring, specifically at the 2, 3, and 4 positions relative to the carboxylic acid group. This compound typically appears as a solid at room temperature and is known for its relatively high melting point due to strong intermolecular interactions, including hydrogen bonding from the carboxylic acid functional group. The presence of halogen substituents, such as bromine and fluorine, can significantly influence its chemical reactivity, polarity, and solubility in various solvents. It may exhibit unique properties in terms of acidity and reactivity compared to other benzoic acids, making it of interest in synthetic organic chemistry and medicinal chemistry. Additionally, its structural features may contribute to specific biological activities, potentially making it a candidate for further research in pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.

Formula: C₇H₃BrF₂O₂

InChI: InChI=1/C7H3BrF2O2/c8-5-3(7(11)12)1-2-4(9)6(5)10/h1-2H,(H,11,12)

SMILES: c1cc(c(c(c1C(=O)O)Br)F)F

Synonyms:

• Benzoic Acid, 2-Bromo-3,4-Difluoro-
• 2-BROMO-3,4-DIFLUOROBENZOIC ACID

2-Bromo-3,4-difluorobenzoic acid

CAS: 170108-05-1

Formula: C₇H₃BrF₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 236.9983

Ref: IN-DA00AC3F

2-Bromo-3,4-difluorobenzoic acid

CAS: 170108-05-1

2-Bromo-3,4-difluorobenzoic acid

Formula: C₇H₃BrF₂O₂

Purity: 98%

Color and Shape: off white to faint peach powder

Molecular weight: 237.00g/mol

Ref: 54-PC408284

2-Bromo-3,4-difluorobenzoic acid

CAS: 170108-05-1

Formula: C₇H₃BrF₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 237

Ref: 10-F237379