CAS 17011-78-8
:4-phenylazobenzyloxycarbonyl-pro-leu-*gly-pro-D-A
Description:
4-Phenylazobenzyloxycarbonyl-pro-leu-gly-pro-D-A, with the CAS number 17011-78-8, is a synthetic compound that belongs to the class of peptide derivatives. This substance features an azobenzene moiety, which is known for its ability to undergo reversible photoisomerization, making it useful in various applications, including photochemical switches and drug delivery systems. The presence of the benzyloxycarbonyl (Z) protecting group indicates that it is likely involved in peptide synthesis, providing stability and protecting the amino group during chemical reactions. The specific sequence of amino acids, including proline (pro), leucine (leu), glycine (gly), and D-alanine (D-A), suggests that this compound may exhibit unique biological activities, potentially influencing its interactions with biological targets. Its structural characteristics may also contribute to its solubility, stability, and reactivity in different environments. Overall, this compound is of interest in the fields of medicinal chemistry and biochemistry, particularly in the development of peptide-based therapeutics.
Formula:C38H52N10O8
InChI:InChI=1/C38H52N10O8/c1-24(2)21-29(33(50)42-22-32(49)47-19-7-12-30(47)34(51)43-28(36(53)54)11-6-18-41-37(39)40)44-35(52)31-13-8-20-48(31)38(55)56-23-25-14-16-27(17-15-25)46-45-26-9-4-3-5-10-26/h3-5,9-10,14-17,24,28-31H,6-8,11-13,18-23H2,1-2H3,(H,42,50)(H,43,51)(H,44,52)(H,53,54)(H4,39,40,41)/b46-45+/t28-,29+,30+,31+/m1/s1
Synonyms:- PZ-Peptide
- N2-(1-(N-(N-(1-(((4-(Phenylazo)phenyl)methoxy)carbonyl)-L-prolyl)-L-leucyl)glycyl)-L-prolyl)-D-arginine
- 1-[({4-[(E)-phenyldiazenyl]benzyl}oxy)carbonyl]-L-prolyl-L-leucylglycyl-L-prolyl-N~5~-(diaminomethylidene)-D-ornithine
- 4-Phenylazobenzyloxycarbonyl-L-Pro-Leu-Gly-Pro-D-Arg Dihydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Pz-Pro-Leu-Gly-Pro-D-Arg-OH
CAS:Chromogenic substrate for the assay of collagenase and thimet oligopeptidase (Pz-peptidase, metalloendopeptidase 24.15, collagenase-like peptidase). Enzymatic cleavage yields Pz-Pro-Leu-OH (or Pz-Pro-OH). The cleavage can be monitored by analytical HPLC, detection at 320 nm.Formula:C38H52N10O8Purity:99.5%Color and Shape:Orange PowderMolecular weight:776.89Pz-Pro-Leu-Gly-Pro-D-Arg-OH trifluoroacetate salt
CAS:Pz-Pro-Leu-Gly-Pro-D-Arg-OH trifluoroacetate salt is a synthetic substrate that can be used for the synthesis of cyclic peptides. It has been shown to act as a competitive inhibitor of the serine protease, chymotrypsin, and cytochalasin B. Pz-Pro-Leu-Gly-Pro-D-Arg is a soluble substrate that can be used in tissue culture experiments with caco2 cells. This compound also has high solubility and is stable at pH values between 5 and 12. The optimum pH for this compound is 8.
Formula:C38H52N10O8Purity:Min. 95%Molecular weight:776.88 g/molRef: 3D-FP110878
Discontinued product

