CAS 170112-66-0

3,4,5-TRIFLUOROIODOBENZENE

Description:

3,4,5-Trifluoroiodobenzene is an aromatic compound characterized by the presence of three fluorine atoms and one iodine atom attached to a benzene ring. The molecular structure features a highly electronegative trifluoromethyl group, which significantly influences the compound's reactivity and physical properties. This substance is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. Its high electronegativity due to the fluorine atoms contributes to its potential applications in organic synthesis and materials science, particularly in the development of fluorinated compounds. The iodine atom introduces a heavier halogen, which can enhance the compound's utility in various chemical reactions, including nucleophilic substitutions. Additionally, 3,4,5-trifluoroiodobenzene may exhibit unique properties such as increased stability and altered solubility compared to its non-fluorinated counterparts. Safety precautions should be taken when handling this compound, as it may pose health risks and environmental hazards.

Formula: C₆H₂F₃I

InChI: InChI=1/C6H2F3I/c7-4-1-3(10)2-5(8)6(4)9/h1-2H

SMILES: c1c(cc(c(c1F)F)F)I

Synonyms:

• 1,2,3-Trifluoro-5-iodobenzene
• Benzene, 1,2,3-trifluoro-5-iodo-
• 1-Iodo-3,4,5-trifluorobenzene

3,4,5-Trifluoroiodobenzene

CAS: 170112-66-0

Formula: C₆H₂F₃I

Purity: 97%

Color and Shape: Solid

Molecular weight: 257.9798

Ref: IN-DA00ACXO

3,4,5-Trifluoroiodobenzene

CAS: 170112-66-0

3,4,5-Trifluoroiodobenzene

Formula: C₆H₂F₃I

Purity: ≥95%

Color and Shape: clear. pale peach liquid

Molecular weight: 257.98g/mol

Ref: 54-PC2701

3,4,5-Trifluoroiodobenzene

CAS: 170112-66-0

Formula: C₆H₂F₃I

Purity: 97%

Color and Shape: Liquid

Molecular weight: 257.982

Ref: 10-F021385