CAS 170157-61-6
:Boc-L-4-aminomethylphe(Fmoc)
Description:
Boc-L-4-aminomethylphenyl(Fmoc) is a chemical compound commonly used in peptide synthesis and medicinal chemistry. It features a Boc (tert-butyloxycarbonyl) protecting group, which is often employed to protect amine functionalities during synthetic procedures. The Fmoc (9-fluorenylmethoxycarbonyl) group serves as another protective group for amines, allowing for selective deprotection under mild conditions. This compound contains an aminomethylphenyl moiety, which contributes to its potential biological activity and interactions. The presence of both Boc and Fmoc groups makes it versatile for various coupling reactions in peptide synthesis, facilitating the formation of peptide bonds while maintaining the integrity of the amino acid side chains. Its structure allows for stability under standard laboratory conditions, while the protective groups can be selectively removed when needed, making it a valuable intermediate in the synthesis of more complex molecules. Overall, Boc-L-4-aminomethylphenyl(Fmoc) is significant in the field of organic chemistry, particularly in the development of pharmaceuticals and bioconjugates.
Formula:C30H32N2O6
InChI:InChI=1/C30H32N2O6/c1-30(2,3)38-29(36)32-26(27(33)34)16-19-12-14-20(15-13-19)17-31-28(35)37-18-25-23-10-6-4-8-21(23)22-9-5-7-11-24(22)25/h4-15,25-26H,16-18H2,1-3H3,(H,31,35)(H,32,36)(H,33,34)/t26-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](Cc1ccc(cc1)CN=C(O)OCC1c2ccccc2c2ccccc12)C(=O)O)O
Synonyms:- N-(tert-butoxycarbonyl)-4-({[(9H-fluoren-9-ylmethoxy)carbonyl]amino}methyl)-L-phenylalanine
- Boc-L-4-Aminomethylphenylalanine(Fmoc)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Boc-l-4-aminomethylphenylalanine(fmoc)
CAS:Formula:C30H32N2O6Purity:95%Color and Shape:SolidMolecular weight:516.58494-{[(9H-Fluoren-9-ylmethoxycarbonyl)amino]methyl}-L-phenylalanine, N-BOC protected
CAS:4-{[(9H-Fluoren-9-ylmethoxycarbonyl)amino]methyl}-L-phenylalanine, N-BOC protectedPurity:95%Boc-4-(Fmoc-aminomethyl)-L-phenylalanine
CAS:Boc-4-(Fmoc-aminomethyl)-L-phenylalanine is a useful scaffold that is used as a building block in the synthesis of complex compounds. This compound is also known as Boc-L-Phe, and has CAS number 170157-61-6. It can be used as an intermediate in the synthesis of many different compounds, and can be converted to other functional groups through chemical reactions. Boc-4-(Fmoc-aminomethyl)-L-phenylalanine has a variety of uses, including being a reagent for peptide synthesis and being a reaction component in organic chemistry.Formula:C30H32N2O6Purity:Min. 95%Color and Shape:PowderMolecular weight:516.58 g/mol


