CAS 17017-71-9

1-benzyl-1H-indole-2-carboxylic acid

Description:

1-Benzyl-1H-indole-2-carboxylic acid is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a benzyl group attached to the nitrogen of the indole and a carboxylic acid functional group at the 2-position of the indole. It typically appears as a solid at room temperature and is soluble in organic solvents. The presence of the carboxylic acid group contributes to its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the indole moiety is known for its biological activity, making this compound of interest in medicinal chemistry and drug development. Its unique structure may also influence its interactions with biological targets, potentially leading to applications in pharmaceuticals. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₆H₁₃NO₂

InChI: InChI=1/C16H13NO2/c18-16(19)15-10-13-8-4-5-9-14(13)17(15)11-12-6-2-1-3-7-12/h1-10H,11H2,(H,18,19)

SMILES: c1ccc(cc1)Cn1c2ccccc2cc1C(=O)O

Synonyms:

• 1H-indole-2-carboxylic acid, 1-(phenylmethyl)-

1-Benzyl-1H-indole-2-carboxylic acid

CAS: 17017-71-9

Formula: C₁₆H₁₃NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 251.2799

Ref: IN-DA0078Y7

1-Benzyl-1H-indole-2-carboxylic acid

CAS: 17017-71-9

1-Benzyl-1H-indole-2-carboxylic acid

Purity: 95%

Molecular weight: 251.29g/mol

Ref: 54-OR1064884

1-Benzyl-1H-indole-2-carboxylic acid

CAS: 17017-71-9

1-Benzyl-1H-indole-2-carboxylic acid is a molecule that binds to chemokine receptors and has been used in screening assays as a chemical probe of chemokine receptor binding. It has been shown to be an antagonist of the CXCR3 receptor, with high affinity and selectivity. 1-Benzyl-1H-indole-2-carboxylic acid is also an antagonist of the CCR5 receptor, with low affinity. This compound was discovered by screening for novel antagonists of chemokines.

Formula: C₁₆H₁₃NO₂

Purity: Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 251.28 g/mol

Ref: 3D-FB124718