CAS 17019-92-0
:11-KETO-BETA-BOSWELLIC ACID
Description:
11-Keto-beta-boswellic acid (CAS 17019-92-0) is a pentacyclic triterpenoid derived from the resin of the Boswellia serrata tree, commonly known for its anti-inflammatory properties. This compound is characterized by its unique chemical structure, which includes a ketone functional group at the 11th position of the beta-boswellic acid framework. It exhibits a range of biological activities, including the inhibition of pro-inflammatory cytokines and enzymes, making it of interest in therapeutic applications, particularly for conditions like arthritis and inflammatory diseases. Additionally, 11-keto-beta-boswellic acid has been studied for its potential anticancer properties, as it may induce apoptosis in certain cancer cell lines. The substance is typically found in a solid state at room temperature and is soluble in organic solvents. Its safety profile and pharmacokinetics are subjects of ongoing research, highlighting its potential as a natural therapeutic agent. Overall, 11-keto-beta-boswellic acid represents a significant compound in the field of natural products and medicinal chemistry.
Formula:C30H46O4
InChI:InChI=1S/C30H46O4/c1-17-8-11-26(3)14-15-28(5)19(23(26)18(17)2)16-20(31)24-27(4)12-10-22(32)30(7,25(33)34)21(27)9-13-29(24,28)6/h16-18,21-24,32H,8-15H2,1-7H3,(H,33,34)/t17-,18+,21-,22-,23+,24-,26-,27+,28-,29-,30-/m1/s1
InChI key:InChIKey=YIMHGPSYDOGBPI-YZCVQEKWSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)([C@](C(O)=O)(C)[C@H](O)CC3)[H])(C(=O)C=C4[C@@]2(C)CC[C@]5(C)[C@]4([C@@H](C)[C@H](C)CC5)[H])[H]
Synonyms:- (3Alpha)-3-Hydroxy-11-Oxours-12-En-24-Oic Acid
- (3Alpha,5Xi,9Xi,18Xi)-3-Hydroxy-11-Oxours-12-En-24-Oic Acid
- (3α,4β)-3-Hydroxy-11-oxours-12-en-23-oic acid
- 11-Keto-β-boswellic acid
- 11-Oxo-β-boswellic acid
- 11-keto-β-Boswellic
- Beta-Boswellic Acid,11-Keto
- KBA (keto boswellic acid)
- Urs-12-en-23-oic acid, 3-hydroxy-11-oxo-, (3α,4β)-
- Urs-12-en-24-oic acid, 3α-hydroxy-11-oxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
11-keto-β-boswellic acid
CAS:11-keto-beta-boswellic acid analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C30H46O4Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:470.711-Keto-β-boswellic acid
CAS:Formula:C30H46O4Purity:98%Color and Shape:SolidMolecular weight:470.683811-Keto-β-boswellic acid
CAS:Formula:C30H46O4Purity:(HPLC) ≥ 98.0%Color and Shape:White powderMolecular weight:470.6811-Keto-β-boswellic acid
CAS:11-Keto-beta-boswellic acid, a novel Nrf2 activator, and a selective 5-lipoxygenase (5-LOX) inhibitor; it exerts dose dependent cardioprotective effect manifested by dose-dependent reduction in serum lactate dehydrogenase; and it can increase the Nrf2 and HO-1 expression, which provides protection against oxygen and glucose deprivation (OGD)-induced oxidative insult. 11-Keto-beta-boswellic acid possesses significant anti-inflammatory, and anti-tumoral activities.Formula:C30H46O4Purity:95%~99%Molecular weight:470.69411-Keto-β-boswellic acid
CAS:11-Keto-beta-boswellic acid, a novel Nrf2 activator, and a selective 5-lipoxygenase (5-LOX) inhibitor, exerts dose dependent cardioprotective effect manifested.Formula:C30H46O4Purity:99.68%Color and Shape:SolidMolecular weight:470.68Ref: TM-TN1182
1mg57.00€5mg130.00€10mg200.00€25mg338.00€50mg497.00€100mg710.00€1mL*10mM (DMSO)133.00€11-keto-β-boswellic acid
CAS:Carboxylic acid with additional oxygen functionsFormula:C30H46O4Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:470.711-Keto-beta-boswellic acid
CAS:Controlled Product11-Keto-beta-boswellic acid is a pentacyclic triterpenoid, which is derived from the resin of Boswellia species, commonly known as frankincense. This compound is characterized by its unique structure, which plays a significant role in its biological activities. As a bioactive compound, its mode of action primarily involves the inhibition of specific enzymes such as 5-lipoxygenase, which is crucial in the leukotriene biosynthesis pathway. This inhibition leads to a reduction in the synthesis of pro-inflammatory mediators, thereby exerting anti-inflammatory effects.Formula:C30H46O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:470.68 g/mol11-Keto β-Boswellic Acid
CAS:Controlled ProductFormula:C30H46O4Color and Shape:NeatMolecular weight:470.68









