CAS 170230-88-3

3-Borono-4-methylbenzoic acid

Description:

3-Borono-4-methylbenzoic acid, with the CAS number 170230-88-3, is an organic compound that features a boronic acid functional group attached to a methyl-substituted benzoic acid structure. This compound is characterized by its aromatic ring, which enhances its stability and reactivity. The presence of the boron atom allows for unique interactions, particularly in the formation of covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. The carboxylic acid group contributes to its acidity and solubility in polar solvents, while the methyl group influences its steric properties and overall reactivity. 3-Borono-4-methylbenzoic acid is often utilized in Suzuki coupling reactions, a key method in the formation of carbon-carbon bonds, which is essential for constructing complex organic molecules. Its ability to participate in such reactions makes it a significant building block in the development of pharmaceuticals and advanced materials. Overall, this compound exemplifies the intersection of boron chemistry and organic synthesis, showcasing its versatility in chemical applications.

Formula: C₈H₉BO₄

InChI: InChI=1S/C8H9BO4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4,12-13H,1H3,(H,10,11)

InChI key: InChIKey=OEGYTHZGLBLPCE-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CC(C(O)=O)=CC=C1C

Synonyms:

• Benzoic acid, 3-borono-4-methyl-
• 3-Borono-4-methylbenzoic acid

3-Borono-4-methylbenzoic acid

CAS: 170230-88-3

Formula: C₈H₉BO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.9657

Ref: IN-DA0078WU

5-Carboxy-2-methylphenylboronic acid

CAS: 170230-88-3

5-Carboxy-2-methylphenylboronic acid

Purity: 98%

Molecular weight: 179.97g/mol

Ref: 54-OR360884

5-Carboxy-2-methylphenylboronic Acid

Controlled Product

CAS: 170230-88-3

Applications 5-Carboxy-2-methylphenylboronic Acid acts as a reagent in the synthesis of pyrazolopyridinone-based p38 MAP kinase inhibitor
References Milburn, R. R., et al.: Org. Process Res. Dev., 15, 31 (2011); Achmatowicz, M., et al.: J. Org. Chem., 74, 795 (2009)

Formula: C₈H₉BO₄

Color and Shape: Neat

Molecular weight: 179.97

Ref: TR-C181058

3-Borono-4-methylbenzoic acid

CAS: 170230-88-3

Formula: C₈H₉BO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.97

Ref: 10-F222465

5-Carboxy-2-methylphenylboronic acid

CAS: 170230-88-3

Versatile small molecule scaffold

Formula: C₈H₉BO₄

Purity: Min. 95%

Molecular weight: 179.97 g/mol

Ref: 3D-VGA23088