CymitQuimica logo

CAS 170284-71-6

:

n-boc-4-(4'-chloro) benzyl-4-piperidine carboxylic acid

Description:
N-Boc-4-(4'-chloro)benzyl-4-piperidine carboxylic acid is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The "n-Boc" (tert-butoxycarbonyl) group serves as a protecting group for the amine, enhancing the compound's stability and solubility in organic solvents. The presence of the 4-chlorobenzyl substituent introduces a halogen, which can influence the compound's reactivity and biological activity. This compound is typically used in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals due to its potential as a building block for more complex molecules. Its carboxylic acid functional group contributes to its acidity and can participate in various chemical reactions, such as esterification or amidation. The specific arrangement of substituents on the piperidine ring and the benzyl group can affect the compound's pharmacological properties, making it of interest in drug design and development. Overall, n-Boc-4-(4'-chloro)benzyl-4-piperidine carboxylic acid is a versatile intermediate in synthetic organic chemistry.
Formula:C18H24ClNO4
InChI:InChI=1S/C18H24ClNO4/c1-17(2,3)24-16(23)20-10-8-18(9-11-20,15(21)22)12-13-4-6-14(19)7-5-13/h4-7H,8-12H2,1-3H3,(H,21,22)
InChI key:MRYZLPQGWRXSTE-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)(CC2=CC=C(C=C2)Cl)C(=O)O
Synonyms:
  • 1-Boc-4-[(4-Chlorophenyl)Methyl]-4-Piperidinecarboxylic Acid
  • 1-(Tert-Butoxycarbonyl)-4-(4-Chlorobenzyl)Piperidine-4-Carboxylic Acid
Found 3 products.