CAS 170381-16-5
:(-)-trans-4-[(1R,3S)-6-Chloro-3-phenylindan-1-yl]-1,2,2-trimethylpiperazine
Description:
The chemical substance known as (-)-trans-4-[(1R,3S)-6-Chloro-3-phenylindan-1-yl]-1,2,2-trimethylpiperazine, with the CAS number 170381-16-5, is a synthetic organic compound characterized by its complex structure, which includes a piperazine ring and a phenylindan moiety. This compound exhibits chirality, indicated by the presence of specific stereocenters, which can influence its biological activity and interactions. The presence of a chlorine atom in its structure may contribute to its reactivity and potential pharmacological properties. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The specific stereochemistry and functional groups present in this compound can affect its solubility, stability, and binding affinity to biological targets. As with many synthetic organic compounds, understanding its characteristics requires consideration of its physical properties, such as melting point, boiling point, and solubility, as well as its behavior in biological systems.
Formula:C22H27ClN2
InChI:InChI=1S/C22H27ClN2/c1-22(2)15-25(12-11-24(22)3)21-14-19(16-7-5-4-6-8-16)18-10-9-17(23)13-20(18)21/h4-10,13,19,21H,11-12,14-15H2,1-3H3/t19-,21+/m0/s1
InChI key:InChIKey=BYPMJBXPNZMNQD-PZJWPPBQSA-N
SMILES:ClC=1C=C2[C@@H](C[C@H](C2=CC1)C3=CC=CC=C3)N4CC(C)(C)N(C)CC4
Synonyms:- Zicronapine
- (-)-trans-4-[(1R,3S)-6-Chloro-3-phenylindan-1-yl]-1,2,2-trimethylpiperazine
- 4-[(1R,3S)-6-Chloro-2,3-dihydro-3-phenyl-1H-inden-1-yl]-1,2,2-trimethylpiperazine
- Piperazine, 4-(6-chloro-2,3-dihydro-3-phenyl-1H-inden-1-yl)-1,2,2-trimethyl-, trans-(-)-
- Piperazine, 4-[(1R,3S)-6-chloro-2,3-dihydro-3-phenyl-1H-inden-1-yl]-1,2,2-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Zicronapine
CAS:Zicronapine (LU 31-130), an atypical antipsychotic with monoaminergic action, targets dopamine D1/D2 and serotonin 5HT2A.Formula:C22H27ClN2Color and Shape:SolidMolecular weight:354.92
