CAS 1704063-98-8

B-[4-Fluoro-3-[(1-methylethoxy)methyl]phenyl]boronic acid

Description:

B-[4-Fluoro-3-[(1-methylethoxy)methyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. The compound features a phenyl ring substituted with a fluorine atom and a branched alkoxy group, which enhances its solubility and reactivity. The presence of the boronic acid moiety allows for participation in cross-coupling reactions, making it valuable in organic synthesis, especially in the development of pharmaceuticals and agrochemicals. Additionally, the fluorine substitution can influence the electronic properties of the molecule, potentially affecting its reactivity and interaction with biological targets. Overall, this compound exemplifies the versatility of boronic acids in synthetic chemistry and their role in the development of complex organic molecules.

Formula: C₁₀H₁₄BFO₃

InChI: InChI=1S/C10H14BFO3/c1-7(2)15-6-8-5-9(11(13)14)3-4-10(8)12/h3-5,7,13-14H,6H2,1-2H3

InChI key: InChIKey=PEFYBLKXYIMKRY-UHFFFAOYSA-N

SMILES: C(OC(C)C)C1=CC(B(O)O)=CC=C1F

Synonyms:

• Boronic acid, B-[4-fluoro-3-[(1-methylethoxy)methyl]phenyl]-
• B-[4-Fluoro-3-[(1-methylethoxy)methyl]phenyl]boronic acid

{4-fluoro-3-[(propan-2-yloxy)methyl]phenyl}boronic acid

CAS: 1704063-98-8

Formula: C₁₀H₁₄BFO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 212.0258

Ref: IN-DA00ARP1

(4-Fluoro-3-(isopropoxymethyl)phenyl)boronic acid

CAS: 1704063-98-8

Purity: 95%

Molecular weight: 212.0299988

Ref: 10-F770901