CAS 1704064-12-9
:B-[3-Fluoro-4-[2-(4-methyl-1-piperazinyl)ethoxy]phenyl]boronic acid
Description:
B-[3-Fluoro-4-[2-(4-methyl-1-piperazinyl)ethoxy]phenyl]boronic acid is an organic compound characterized by its boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including drug development and organic synthesis. The presence of the 3-fluoro substituent on the phenyl ring enhances its electronic properties, potentially influencing its reactivity and interaction with biological targets. The ethoxy group linked to a piperazine moiety contributes to its solubility and may enhance its pharmacological profile. This compound is likely to exhibit moderate to high polarity due to the presence of both the boronic acid and the piperazine functionalities. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of inhibitors or modulators for specific biological pathways. As with many boronic acids, it may also be involved in cross-coupling reactions in synthetic organic chemistry, highlighting its versatility as a building block in complex molecule synthesis.
Formula:C13H20BFN2O3
InChI:InChI=1S/C13H20BFN2O3/c1-16-4-6-17(7-5-16)8-9-20-13-3-2-11(14(18)19)10-12(13)15/h2-3,10,18-19H,4-9H2,1H3
InChI key:InChIKey=KQXALTFHYHIKTN-UHFFFAOYSA-N
SMILES:O(CCN1CCN(C)CC1)C2=C(F)C=C(B(O)O)C=C2
Synonyms:- Boronic acid, B-[3-fluoro-4-[2-(4-methyl-1-piperazinyl)ethoxy]phenyl]-
- B-[3-Fluoro-4-[2-(4-methyl-1-piperazinyl)ethoxy]phenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boronic acid, B-[3-fluoro-4-[2-(4-methyl-1-piperazinyl)ethoxy]phenyl]-
CAS:Formula:C13H20BFN2O3Molecular weight:282.1189
