CAS 1704064-37-8

4-(5-Iodo-3-methyl-2-pyridinyl)morpholine

Description:

4-(5-Iodo-3-methyl-2-pyridinyl)morpholine is a chemical compound characterized by its unique structure, which includes a morpholine ring and a pyridine moiety substituted with an iodine atom and a methyl group. The presence of the iodine atom contributes to its potential reactivity and biological activity, making it of interest in medicinal chemistry. Morpholine, a six-membered heterocyclic compound containing both nitrogen and oxygen, imparts certain pharmacological properties, such as the ability to act as a base and participate in hydrogen bonding. The compound's molecular structure suggests it may exhibit lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the presence of the pyridine ring may enhance its interaction with biological targets, potentially leading to applications in drug development. Overall, the characteristics of this compound, including its molecular weight, solubility, and reactivity, are essential for understanding its potential uses in various chemical and pharmaceutical applications.

Formula: C₁₀H₁₃IN₂O

InChI: InChI=1S/C10H13IN2O/c1-8-6-9(11)7-12-10(8)13-2-4-14-5-3-13/h6-7H,2-5H2,1H3

InChI key: InChIKey=KOXPSUFTAKJXJZ-UHFFFAOYSA-N

SMILES: CC1=C(N2CCOCC2)N=CC(I)=C1

Synonyms:

• 4-(5-Iodo-3-methyl-2-pyridinyl)morpholine
• Morpholine, 4-(5-iodo-3-methyl-2-pyridinyl)-