CymitQuimica logo

CAS 1704065-17-7

:

1-[(2-Bromo-5-fluorophenyl)methyl]pyrrolidine

Description:
1-[(2-Bromo-5-fluorophenyl)methyl]pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a substituted phenyl group. The presence of a bromine and a fluorine atom on the phenyl ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrrolidine moiety, which is often found in various bioactive compounds. Additionally, the halogen substituents can influence the compound's lipophilicity and interaction with biological targets. Safety and handling precautions should be observed, as halogenated compounds can pose health risks. Overall, 1-[(2-Bromo-5-fluorophenyl)methyl]pyrrolidine represents a compound of interest for further research in chemical and pharmaceutical sciences.
Formula:C11H13BrFN
InChI:InChI=1S/C11H13BrFN/c12-11-4-3-10(13)7-9(11)8-14-5-1-2-6-14/h3-4,7H,1-2,5-6,8H2
InChI key:InChIKey=GOABUXVZQCMBJJ-UHFFFAOYSA-N
SMILES:C(C1=C(Br)C=CC(F)=C1)N2CCCC2
Synonyms:
  • 1-[(2-Bromo-5-fluorophenyl)methyl]pyrrolidine
  • Pyrrolidine, 1-[(2-bromo-5-fluorophenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.