CymitQuimica logo

CAS 1704066-83-0

:

B-[3-Fluoro-5-[(2,2,2-trifluoroethoxy)methyl]phenyl]boronic acid

Description:
B-[3-Fluoro-5-[(2,2,2-trifluoroethoxy)methyl]phenyl]boronic acid is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group that is further substituted with a fluorine atom and a trifluoroethoxy group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of fluorine atoms enhances its lipophilicity and may influence its biological activity. Additionally, the trifluoroethoxy group contributes to the compound's stability and solubility in organic solvents. As a boronic acid, it may also participate in Suzuki coupling reactions, which are valuable in the formation of carbon-carbon bonds. Overall, this compound's unique structure and functional groups make it a candidate for research in drug development and materials science.
Formula:C9H9BF4O3
InChI:InChI=1S/C9H9BF4O3/c11-8-2-6(1-7(3-8)10(15)16)4-17-5-9(12,13)14/h1-3,15-16H,4-5H2
InChI key:InChIKey=WTOJFSPIBYRSHT-UHFFFAOYSA-N
SMILES:C(OCC(F)(F)F)C1=CC(B(O)O)=CC(F)=C1
Synonyms:
  • B-[3-Fluoro-5-[(2,2,2-trifluoroethoxy)methyl]phenyl]boronic acid
  • Boronic acid, B-[3-fluoro-5-[(2,2,2-trifluoroethoxy)methyl]phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.