CymitQuimica logo

CAS 1704067-21-9

:

4-Bromo-N,N,2,6-tetramethylbenzenesulfonamide

Description:
4-Bromo-N,N,2,6-tetramethylbenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its applications in medicinal chemistry and as a building block in organic synthesis. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and solubility. The tetramethyl substitution on the benzene ring contributes to steric hindrance, potentially affecting the compound's interactions with biological targets or other reagents. This compound is likely to exhibit moderate polarity due to the sulfonamide group, which can engage in hydrogen bonding. Additionally, the bulky tetramethyl groups may enhance lipophilicity, impacting its bioavailability and pharmacokinetic properties. As with many sulfonamides, it may possess antibacterial properties, although specific biological activities would need to be evaluated through empirical studies. Overall, 4-Bromo-N,N,2,6-tetramethylbenzenesulfonamide represents a versatile structure with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C10H14BrNO2S
InChI:InChI=1S/C10H14BrNO2S/c1-7-5-9(11)6-8(2)10(7)15(13,14)12(3)4/h5-6H,1-4H3
InChI key:InChIKey=OWTJHTWHVPBMDA-UHFFFAOYSA-N
SMILES:S(N(C)C)(=O)(=O)C1=C(C)C=C(Br)C=C1C
Synonyms:
  • Benzenesulfonamide, 4-bromo-N,N,2,6-tetramethyl-
  • 4-Bromo-N,N,2,6-tetramethylbenzenesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.