CAS 1704069-28-2
:5-Bromo-N,N-diethyl-2-(trifluoromethoxy)benzenesulfonamide
Description:
5-Bromo-N,N-diethyl-2-(trifluoromethoxy)benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of the bromine atom and the trifluoromethoxy group contributes to its unique reactivity and potential applications in medicinal chemistry. This compound features a diethyl substitution on the nitrogen atom, which can influence its solubility and biological activity. The trifluoromethoxy group enhances lipophilicity, potentially improving membrane permeability. Additionally, the sulfonamide moiety can participate in hydrogen bonding, affecting its interaction with biological targets. The compound's structure suggests it may be of interest in the development of pharmaceuticals, particularly in the context of targeting specific enzymes or receptors. Its CAS number, 1704069-28-2, allows for precise identification in chemical databases and literature. Overall, the combination of halogen and sulfonamide functionalities positions this compound as a candidate for further research in drug discovery and development.
Formula:C11H13BrF3NO3S
InChI:InChI=1S/C11H13BrF3NO3S/c1-3-16(4-2)20(17,18)10-7-8(12)5-6-9(10)19-11(13,14)15/h5-7H,3-4H2,1-2H3
InChI key:InChIKey=YWLABFDKNBZJNV-UHFFFAOYSA-N
SMILES:S(N(CC)CC)(=O)(=O)C1=C(OC(F)(F)F)C=CC(Br)=C1
Synonyms:- 5-Bromo-N,N-diethyl-2-(trifluoromethoxy)benzenesulfonamide
- Benzenesulfonamide, 5-bromo-N,N-diethyl-2-(trifluoromethoxy)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery