CAS 1704069-57-7

B-[3-[[(3-Methoxyphenyl)amino]carbonyl]phenyl]boronic acid

Description:

B-[3-[[(3-Methoxyphenyl)amino]carbonyl]phenyl]boronic acid, identified by its CAS number 1704069-57-7, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group and an amino acid moiety. This compound features a methoxy-substituted phenyl group, which enhances its solubility and reactivity. The boronic acid functional group is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. The presence of the amino and carbonyl groups suggests potential for biological activity, possibly interacting with biological targets or serving as a building block in drug development. Additionally, the compound's structural features may contribute to its role in cross-coupling reactions, a key method in the formation of carbon-carbon bonds in organic synthesis. Overall, this compound exemplifies the versatility of boronic acids in both synthetic and pharmaceutical chemistry.

Formula: C₁₄H₁₄BNO₄

InChI: InChI=1S/C14H14BNO4/c1-20-13-7-3-6-12(9-13)16-14(17)10-4-2-5-11(8-10)15(18)19/h2-9,18-19H,1H3,(H,16,17)

InChI key: InChIKey=WDLAMKPWOUMLHK-UHFFFAOYSA-N

SMILES: C(NC1=CC(OC)=CC=C1)(=O)C2=CC(B(O)O)=CC=C2

Synonyms:

• Boronic acid, B-[3-[[(3-methoxyphenyl)amino]carbonyl]phenyl]-
• B-[3-[[(3-Methoxyphenyl)amino]carbonyl]phenyl]boronic acid

{3-[(3-methoxyphenyl)carbamoyl]phenyl}boronic acid

CAS: 1704069-57-7

Formula: C₁₄H₁₄BNO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 271.0763

Ref: IN-DA00AR7S

(3-((3-Methoxyphenyl)carbamoyl)phenyl)boronic acid

CAS: 1704069-57-7

Purity: 95%

Molecular weight: 271.0799866

Ref: 10-F770809