CAS 1704073-31-3
:B-[2-(4-Ethyl-1-piperazinyl)-5-pyrimidinyl]boronic acid
Description:
B-[2-(4-Ethyl-1-piperazinyl)-5-pyrimidinyl]boronic acid is a boronic acid derivative characterized by its unique structural features, which include a boron atom bonded to a pyrimidine ring and a piperazine moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The presence of the piperazine ring contributes to its potential biological activity, as piperazine derivatives are often explored for their pharmacological properties. Additionally, the ethyl substituent on the piperazine enhances lipophilicity, potentially influencing the compound's solubility and permeability. The compound's boronic acid functionality may also play a role in its reactivity and interaction with biological targets, making it a candidate for further research in drug development. Overall, B-[2-(4-Ethyl-1-piperazinyl)-5-pyrimidinyl]boronic acid represents a versatile structure with potential applications in various fields of chemistry and biology.
Formula:C10H17BN4O2
InChI:InChI=1S/C10H17BN4O2/c1-2-14-3-5-15(6-4-14)10-12-7-9(8-13-10)11(16)17/h7-8,16-17H,2-6H2,1H3
InChI key:InChIKey=CQGKVPNBPCFPJJ-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C=NC(=NC1)N2CCN(CC)CC2
Synonyms:- Boronic acid, B-[2-(4-ethyl-1-piperazinyl)-5-pyrimidinyl]-
- [2-(4-Ethylpiperazin-1-yl)pyrimidin-5-yl]boronic acid
- B-[2-(4-Ethyl-1-piperazinyl)-5-pyrimidinyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(2-(4-Ethylpiperazin-1-yl)pyrimidin- 5-yl)boronic acid
CAS:Formula:C10H17BN4O2Color and Shape:SolidMolecular weight:236.0786
