CymitQuimica logo

CAS 1704073-94-8

:

B-[4-(1,4-Dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]boronic acid

Description:
B-[4-(1,4-Dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]boronic acid, identified by its CAS number 1704073-94-8, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group and a complex spirocyclic structure. This compound features a unique bicyclic system that includes a dioxane and an azaspiro moiety, contributing to its potential biological activity and utility in medicinal chemistry. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including drug development and materials science. The presence of the boronic acid functional group suggests potential applications in targeted drug delivery and as a building block in organic synthesis. Additionally, the compound may exhibit interesting properties related to its solubility, reactivity, and interaction with biological targets, which could be explored further in research settings. Overall, this compound represents a fascinating intersection of organic chemistry and pharmacology.
Formula:C14H20BNO4
InChI:InChI=1S/C14H20BNO4/c17-15(18)13-3-1-12(2-4-13)11-16-7-5-14(6-8-16)19-9-10-20-14/h1-4,17-18H,5-11H2
InChI key:InChIKey=JKIZTNBKBGWIAF-UHFFFAOYSA-N
SMILES:C(N1CCC2(CC1)OCCO2)C3=CC=C(B(O)O)C=C3
Synonyms:
  • B-[4-(1,4-Dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]boronic acid
  • Boronic acid, B-[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-
Found 1 products.