CAS 17041-60-0
:dimethyl ethylidenemalonate
Description:
Dimethyl ethylidenemalonate, with the CAS number 17041-60-0, is an organic compound characterized by its structure, which includes two methoxy groups and a malonate framework. It is typically a colorless to pale yellow liquid with a fruity odor. This compound is known for its reactivity, particularly in organic synthesis, where it can participate in various chemical reactions such as Michael additions and condensation reactions. Its molecular structure allows it to act as a versatile building block in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Dimethyl ethylidenemalonate is soluble in organic solvents, making it suitable for use in various chemical processes. Additionally, it exhibits moderate stability under standard conditions but should be handled with care due to potential reactivity. As with many organic compounds, safety precautions should be taken to avoid exposure, and it should be stored in a cool, dry place away from incompatible materials.
Formula:C7H10O4
InChI:InChI=1/C7H10O4/c1-4-5(6(8)10-2)7(9)11-3/h4H,1-3H3
SMILES:CC=C(C(=O)OC)C(=O)OC
Synonyms:- Dimethyl Ethylidenepropanedioate
- (Ethylidene)propanedioic acid dimethyl ester
- Propanedioic acid, 2-ethylidene-, 1,3-dimethyl ester
- DIMETHYL ETHYLIDENEMALONATE
- diMethyl 2-ethylidenepropanedioate
- Dimethyl 2-ethylidenemalonate
- Dimethyl ethylidenemalonate 98%
- 4-hydroxy-1,5-dimethyl-2-phenyl-3-pyrazolone
- Dimethyl 1-propene-1,1-dicarboxylate
- Ethylidenemalonic acid dimethyl ester
- 2-Ethylidene-malonic acid 1,3-dimethyl ester
- 1-Propene-1,1-dicarboxylic acid dimethyl ester
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Dimethyl 2-ethylidenemalonate
CAS:Formula:C7H10O4Purity:95%Color and Shape:LiquidMolecular weight:158.1519Dimethyl 2-ethylidenemalonate
CAS:Formula:C7H10O4Purity:95%Color and Shape:LiquidMolecular weight:158.153Dimethyl ethylidenemalonate
CAS:Dimethyl ethylidenemalonate is a maleate that can be used as an acceptor for chloride, and it has been shown to be a reactive donor in catalysis. It has also been shown to have anti-inflammatory properties that may be due to its ability to modulate metal ion activity. Dimethyl ethylidenemalonate has also been found to inhibit cellular corrosion and regulate the production of allylation by cells. This chemical is used as a corrosion inhibitor and modulator for metal ions such as aluminum, zinc, and chromium. Alginic acid is also derived from dimethyl ethylidenemalonate.
Formula:C7H10O4Purity:Min. 90%Color and Shape:Clear LiquidMolecular weight:158.15 g/mol



