CAS 170434-11-4
:5-Bromo-2-(hydroxymethyl)phenol
Description:
5-Bromo-2-(hydroxymethyl)phenol is an organic compound characterized by the presence of a bromine atom and a hydroxymethyl group attached to a phenolic ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents. Its molecular structure features a bromine substituent at the 5-position and a hydroxymethyl group at the 2-position of the phenol ring, which contributes to its reactivity and potential applications in various chemical processes. The presence of the hydroxymethyl group enhances its ability to participate in further chemical reactions, such as etherification or esterification. This compound may exhibit antimicrobial properties, making it of interest in pharmaceutical and agricultural applications. Additionally, it can serve as an intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential hazards associated with brominated compounds.
Formula:C7H7BrO2
InChI:InChI=1/C7H7BrO2/c8-6-2-1-5(4-9)7(10)3-6/h1-3,9-10H,4H2
SMILES:c1cc(cc(c1CO)O)Br
Synonyms:- Benzenemethanol, 4-Bromo-2-Hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Bromo-2-(hydroxymethyl)phenol
CAS:Formula:C7H7BrO2Purity:96%Color and Shape:SolidMolecular weight:203.03335-Bromo-2-(hydroxymethyl)phenol
CAS:5-Bromo-2-(hydroxymethyl)phenolPurity:95%Molecular weight:203.03g/mol5-Bromo-2-(hydroxymethyl)phenol
CAS:Formula:C7H7BrO2Purity:96%Color and Shape:SolidMolecular weight:203.0355-Bromo-2-(hydroxymethyl)phenol
CAS:5-Bromo-2-(hydroxymethyl)phenol (5-BHP) is a synthetic small molecule that activates the death receptor CD95. It has been shown to induce tumor regression in experimental models of cancer. 5-BHP can be used as a cancer therapeutic or for the treatment of inflammatory conditions such as rheumatoid arthritis and psoriasis. 5-BHP binds to the death protein pd-l1, which initiates downstream signaling pathways that lead to activation of caspases and apoptosis. This agent also interacts with programmed death ligand 1 (PD-L1), which is expressed on activated T cells and may be involved in antitumor responses. These interactions are being investigated for their potential use in drug development, including optimization and biochemical techniques to characterize the binding affinity of 5-BHP with PD-L1.Formula:C7H7BrO2Purity:Min. 95%Molecular weight:203.03 g/mol



