CAS 170449-35-1

Acetamide, 2-cyano-N-(1-phenylpropyl)-

Description:

Acetamide, 2-cyano-N-(1-phenylpropyl)-, also known by its CAS number 170449-35-1, is an organic compound characterized by the presence of an acetamide functional group and a cyano group attached to a phenylpropyl moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the amide group. The cyano group contributes to its reactivity, making it a candidate for various chemical transformations. The phenylpropyl substituent can influence its physical properties, including melting and boiling points, as well as its biological activity. Compounds of this nature may be of interest in medicinal chemistry and material science due to their potential applications in pharmaceuticals or as intermediates in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, as they may pose health risks or environmental hazards.

Formula: C₁₂H₁₄N₂O

InChI: InChI=1S/C12H14N2O/c1-2-11(14-12(15)8-9-13)10-6-4-3-5-7-10/h3-7,11H,2,8H2,1H3,(H,14,15)

InChI key: InChIKey=VJULKDZVDNRCIQ-UHFFFAOYSA-N

SMILES: C(NC(CC#N)=O)(CC)C1=CC=CC=C1

Synonyms:

• 2-Cyano-N-(1-phenylpropyl)acetamide
• Acetamide, 2-cyano-N-(1-phenylpropyl)-

2-Cyano-N-(1-phenylpropyl)acetamide

CAS: 170449-35-1

Versatile small molecule scaffold

Formula: C₁₂H₁₄N₂O

Purity: Min. 95%

Molecular weight: 202.25 g/mol

Ref: 3D-VGA44935