CAS 170487-39-5

2-Pyridinecarbonitrile, 4-methyl-, 1-oxide

Description:

2-Pyridinecarbonitrile, 4-methyl-, 1-oxide, also known by its CAS number 170487-39-5, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a cyano group (-C≡N) and a methyl group (-CH3) attached to the pyridine ring, as well as an oxide functional group, indicating the presence of an oxygen atom that is likely involved in a resonance structure or as part of a N-oxide. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. Typically, compounds of this nature exhibit polar characteristics due to the electronegative nitrogen and oxygen atoms, influencing their solubility in polar solvents. Additionally, the compound may display biological activity, making it of interest for further research in medicinal chemistry. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.

Formula: C₇H₆N₂O

InChI: InChI=1S/C7H6N2O/c1-6-2-3-9(10)7(4-6)5-8/h2-4H,1H3

InChI key: InChIKey=MRQIJKZOIOOQIC-UHFFFAOYSA-N

SMILES: C(#N)C=1N(=O)=CC=C(C)C1

Synonyms:

• 2-Cyano-4-methylpyridin-1-ium-1-olate
• 2-Cyano-4-methylpyridine 1-oxide
• 2-Cyano-4-methylpyridine N-oxide
• 2-Pyridinecarbonitrile, 4-Methyl-, 1-Oxide
• 4-Methylpyridine-2-carbonitrile 1-oxide

2-Cyano-4-methylpyridine 1-oxide

CAS: 170487-39-5

Formula: C₇H₆N₂O

Molecular weight: 134.138

Ref: 10-F180093