CAS 170508-15-3

1,1-Dimethylethyl N-[2-(hydroxymethyl)spiro[3.3]hept-6-yl]carbamate

Description:

1,1-Dimethylethyl N-[2-(hydroxymethyl)spiro[3.3]hept-6-yl]carbamate, with CAS number 170508-15-3, is a chemical compound characterized by its unique structural features, including a carbamate functional group and a spirocyclic structure. The presence of the dimethyl group contributes to its steric hindrance, potentially influencing its reactivity and interactions with biological systems. The hydroxymethyl group enhances its solubility in polar solvents, which may affect its bioavailability and pharmacokinetics. This compound may exhibit specific biological activities, making it of interest in medicinal chemistry and agrochemical applications. Its spirocyclic framework can impart rigidity, which is often associated with increased selectivity in biological interactions. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, the unique combination of functional groups and structural characteristics makes this compound a subject of interest for further research in various chemical and biological contexts.

Formula: C₁₃H₂₃NO₃

InChI: InChI=1S/C13H23NO3/c1-12(2,3)17-11(16)14-10-6-13(7-10)4-9(5-13)8-15/h9-10,15H,4-8H2,1-3H3,(H,14,16)

InChI key: InChIKey=VHRSRHDORQXSSK-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1CC2(C1)CC(CO)C2

Synonyms:

• 1,1-Dimethylethyl N-[2-(hydroxymethyl)spiro[3.3]hept-6-yl]carbamate
• Carbamic acid, [6-(hydroxymethyl)spiro[3.3]hept-2-yl]-, 1,1-dimethylethyl ester
• Carbamic acid, N-[2-(hydroxymethyl)spiro[3.3]hept-6-yl]-, 1,1-dimethylethyl ester

Carbamic acid, N-[2-(hydroxymethyl)spiro[3.3]hept-6-yl]-, 1,1-dimethylethyl ester

CAS: 170508-15-3

Formula: C₁₃H₂₃NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 241.3266

Ref: IN-DA01RJPV