CymitQuimica logo

CAS 170552-39-3

:

Undecyl 4-O-β-D-glucopyranosyl-β-D-glucopyranoside

Description:
Undecyl 4-O-β-D-glucopyranosyl-β-D-glucopyranoside is a glycoside compound characterized by its structure, which includes a long undecyl chain and two glucose units. The undecyl group contributes hydrophobic properties, while the glucopyranosyl moieties impart hydrophilicity, making this compound amphiphilic. This dual nature allows it to interact with both lipid and aqueous environments, which is particularly useful in applications such as surfactants or emulsifiers. The presence of multiple hydroxyl groups in the glucose units enhances its solubility in water and potential for hydrogen bonding. This compound may exhibit biological activity, including potential antimicrobial or antifungal properties, owing to its glycosidic structure. Additionally, its unique characteristics make it a candidate for use in drug delivery systems or as a stabilizing agent in various formulations. Overall, Undecyl 4-O-β-D-glucopyranosyl-β-D-glucopyranoside represents a versatile compound with potential applications in pharmaceuticals, cosmetics, and food industries.
Formula:C23H44O11
InChI:InChI=1S/C23H44O11/c1-2-3-4-5-6-7-8-9-10-11-31-22-20(30)18(28)21(15(13-25)33-22)34-23-19(29)17(27)16(26)14(12-24)32-23/h14-30H,2-13H2,1H3/t14-,15-,16-,17+,18-,19-,20-,21-,22-,23+/m1/s1
InChI key:InChIKey=UYEMNFYVTFDKRG-GNKAUAAYSA-N
SMILES:O([C@@H]1[C@@H](CO)O[C@@H](OCCCCCCCCCCC)[C@H](O)[C@H]1O)[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O
Synonyms:
  • β-D-Glucopyranoside, undecyl 4-O-β-D-glucopyranosyl-
  • Undecyl 4-O-β-D-glucopyranosyl-β-D-glucopyranoside
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.