CAS 17056-99-4

5-Hydroxyquinoxaline

Description:

5-Hydroxyquinoxaline is an organic compound characterized by its quinoxaline structure, which consists of a fused bicyclic system containing two nitrogen atoms. It features a hydroxyl (-OH) group at the 5-position, which contributes to its chemical reactivity and potential biological activity. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its ability to engage in hydrogen bonding due to the presence of the hydroxyl group. 5-Hydroxyquinoxaline has garnered interest in medicinal chemistry for its potential pharmacological properties, including neuroprotective and anti-inflammatory effects. Its structure allows for various chemical modifications, which can enhance its biological activity or alter its solubility and stability. Additionally, it may serve as a precursor in the synthesis of other quinoxaline derivatives, expanding its utility in research and development. As with many chemical substances, safety precautions should be observed when handling 5-Hydroxyquinoxaline, as its biological effects and toxicity profiles are important considerations in both laboratory and therapeutic contexts.

Formula: C₈H₆N₂O

InChI: InChI=1/C8H6N2O/c11-7-3-1-2-6-8(7)10-5-4-9-6/h1-5,11H

SMILES: c1cc2c(c(c1)O)nccn2

Synonyms:

• 5-Quinoxalinol
• Quinoxalin-5-ol

Quinoxalin-5-ol

CAS: 17056-99-4

Formula: C₈H₆N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 146.1460

Ref: IN-DA007UCD

5-Quinoxalinol

CAS: 17056-99-4

Formula: C₈H₆N₂O

Purity: >98.0%(GC)(T)

Color and Shape: Light yellow to Yellow to Orange powder to crystal

Molecular weight: 146.15

Ref: 3B-Q0095

Quinoxalin-5-ol

CAS: 17056-99-4

Quinoxalin-5-ol

Purity: 98%

Molecular weight: 146.15g/mol

Ref: 54-OR903311

Quinoxalin-5-ol

CAS: 17056-99-4

Formula: C₈H₆N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 146.149

Ref: 10-F076773